C28H26N4O2S — CID 55466922
N-benzyl-N-tert-butyl-2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 55466922) has the molecular formula C28H26N4O2S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-N-tert-butyl-2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 55466922 |
| Molecular Formula | C28H26N4O2S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-benzyl-N-tert-butyl-2-[3-(4-cyanophenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)CSc1nc2ccccc2c(=O)n1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H26N4O2S/c1-28(2,3)31(18-21-9-5-4-6-10-21)25(33)19-35-27-30-24-12-8-7-11-23(24)26(34)32(27)22-15-13-20(17-29)14-16-22/h4-16H,18-19H2,1-3H3 |
| InChIKey | CRWDJVTUSDFVGQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |