C19H15F3N4O3S — CID 52550102
(E)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide (PubChem CID 52550102) has the molecular formula C19H15F3N4O3S and a molecular weight of 436.42 g/mol. Its IUPAC name is (E)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 52550102 |
| Molecular Formula | C19H15F3N4O3S |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (E)-N-(1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidin-6-yl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-enamide |
| SMILES | Cn1c(=O)c2cc(NC(=O)/C=C/c3ccc(SC(F)(F)F)cc3)cnc2n(C)c1=O |
| InChI | InChI=1S/C19H15F3N4O3S/c1-25-16-14(17(28)26(2)18(25)29)9-12(10-23-16)24-15(27)8-5-11-3-6-13(7-4-11)30-19(20,21)22/h3-10H,1-2H3,(H,24,27)/b8-5+ |
| InChIKey | OWDJSYLJSJETFT-VMPITWQZSA-N |
| XLogP | 2.90 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|