C20H14FN5O4S — CID 52553435
1-(3-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 52553435) has the molecular formula C20H14FN5O4S and a molecular weight of 439.43 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 52553435 |
| Molecular Formula | C20H14FN5O4S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-(3-fluorophenyl)-N-(4-methoxy-2-nitrophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2nc(-c3cccs3)n(-c3cccc(F)c3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14FN5O4S/c1-30-14-7-8-15(16(11-14)26(28)29)22-20(27)18-23-19(17-6-3-9-31-17)25(24-18)13-5-2-4-12(21)10-13/h2-11H,1H3,(H,22,27) |
| InChIKey | LOUCAXFXJUMDRD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|