About 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile
6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile (PubChem CID 52560304) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile |
| PubChem CID | 52560304 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(Nc2ccc3c(c2)OC2(CCCCC2)O3)nc1 |
| InChI | InChI=1S/C18H17N3O2/c19-11-13-4-7-17(20-12-13)21-14-5-6-15-16(10-14)23-18(22-15)8-2-1-3-9-18/h4-7,10,12H,1-3,8-9H2,(H,20,21) |
| InChIKey | UGJIMAOQIGYMHP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile?
The IUPAC name of 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile (CID 52560304) is 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile.
What is the SMILES notation for 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile?
The canonical SMILES for 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile is N#Cc1ccc(Nc2ccc3c(c2)OC2(CCCCC2)O3)nc1.
What is the InChIKey of 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile?
The InChIKey is UGJIMAOQIGYMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c19-11-13-4-7-17(20-12-13)21-14-5-6-15-16(10-14)23-18(22-15)8-2-1-3-9-18/h4-7,10,12H,1-3,8-9H2,(H,20,21).
What are the key properties of 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile?
6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile has a molecular weight of 307.35 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)pyridine-3-carbonitrile is sourced from PubChem (CID 52560304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).