C22H22F3N3O3 — CID 52564379
1-[2-nitro-4-(trifluoromethyl)phenyl]-N-phenyl-N-prop-2-enylpiperidine-4-carboxamide (PubChem CID 52564379) has the molecular formula C22H22F3N3O3 and a molecular weight of 433.43 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-phenyl-N-prop-2-enylpiperidine-4-carboxamide.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-phenyl-N-prop-2-enylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 52564379 |
| Molecular Formula | C22H22F3N3O3 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-N-phenyl-N-prop-2-enylpiperidine-4-carboxamide |
| SMILES | C=CCN(C(=O)C1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C22H22F3N3O3/c1-2-12-27(18-6-4-3-5-7-18)21(29)16-10-13-26(14-11-16)19-9-8-17(22(23,24)25)15-20(19)28(30)31/h2-9,15-16H,1,10-14H2 |
| InChIKey | YAHSMBBFBUJCKY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|