C16H11Cl2NO2 — CID 5256865
5-chloro-3-(2-chlorophenyl)-3-hydroxy-1,8a-dihydroazirino[1,2-b]isoquinolin-8-one (PubChem CID 5256865) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 5-chloro-3-(2-chlorophenyl)-3-hydroxy-1,8a-dihydroazirino[1,2-b]isoquinolin-8-one.
| Compound Name | 5-chloro-3-(2-chlorophenyl)-3-hydroxy-1,8a-dihydroazirino[1,2-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 5256865 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-chloro-3-(2-chlorophenyl)-3-hydroxy-1,8a-dihydroazirino[1,2-b]isoquinolin-8-one |
| SMILES | O=C1c2ccc(Cl)cc2C(O)(c2ccccc2Cl)N2CC12 |
| InChI | InChI=1S/C16H11Cl2NO2/c17-9-5-6-10-12(7-9)16(21,19-8-14(19)15(10)20)11-3-1-2-4-13(11)18/h1-7,14,21H,8H2 |
| InChIKey | KYBHYXOQVQUYTH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|