C15H15BrFN3O2 — CID 52572880
N-[(5-bromo-2-fluorophenyl)methyl]-6-oxo-1-propylpyridazine-3-carboxamide (PubChem CID 52572880) has the molecular formula C15H15BrFN3O2 and a molecular weight of 368.21 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-6-oxo-1-propylpyridazine-3-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-6-oxo-1-propylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 52572880 |
| Molecular Formula | C15H15BrFN3O2 |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-6-oxo-1-propylpyridazine-3-carboxamide |
| SMILES | CCCn1nc(C(=O)NCc2cc(Br)ccc2F)ccc1=O |
| InChI | InChI=1S/C15H15BrFN3O2/c1-2-7-20-14(21)6-5-13(19-20)15(22)18-9-10-8-11(16)3-4-12(10)17/h3-6,8H,2,7,9H2,1H3,(H,18,22) |
| InChIKey | RIFSQAITWZJCDX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |