C12H18N2 — CID 525836
N'-benzyl-N,N-dimethylpropanimidamide (PubChem CID 525836) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N'-benzyl-N,N-dimethylpropanimidamide.
| Compound Name | N'-benzyl-N,N-dimethylpropanimidamide |
|---|---|
| PubChem CID | 525836 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-benzyl-N,N-dimethylpropanimidamide |
| SMILES | CC/C(=N\Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C12H18N2/c1-4-12(14(2)3)13-10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3/b13-12+ |
| InChIKey | GTOOPRWBIUWQHJ-OUKQBFOZSA-N |
| XLogP | 2.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|