C21H28ClN3O3S — CID 52586973
2-[(2-chlorophenyl)methyl-ethylamino]-N-[3-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 52586973) has the molecular formula C21H28ClN3O3S and a molecular weight of 437.99 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-ethylamino]-N-[3-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-ethylamino]-N-[3-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 52586973 |
| Molecular Formula | C21H28ClN3O3S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-ethylamino]-N-[3-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(S(=O)(=O)N(CC)CC)c1)Cc1ccccc1Cl |
| InChI | InChI=1S/C21H28ClN3O3S/c1-4-24(15-17-10-7-8-13-20(17)22)16-21(26)23-18-11-9-12-19(14-18)29(27,28)25(5-2)6-3/h7-14H,4-6,15-16H2,1-3H3,(H,23,26) |
| InChIKey | NSYRYPNSEUKLEV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |