C20H27ClN3O3S+ — CID 9306989
[(1R)-1-(2-chlorophenyl)ethyl]-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]azanium (PubChem CID 9306989) has the molecular formula C20H27ClN3O3S+ and a molecular weight of 424.97 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl]-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl]-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9306989 |
| Molecular Formula | C20H27ClN3O3S+ |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl]-[2-[3-(diethylsulfamoyl)anilino]-2-oxoethyl]azanium |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)C[NH2+][C@H](C)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H26ClN3O3S/c1-4-24(5-2)28(26,27)17-10-8-9-16(13-17)23-20(25)14-22-15(3)18-11-6-7-12-19(18)21/h6-13,15,22H,4-5,14H2,1-3H3,(H,23,25)/p+1/t15-/m1/s1 |
| InChIKey | OEDMYDPVPDPFEP-OAHLLOKOSA-O |
| XLogP | 2.63 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |