C19H23N5O — CID 5261038
4-(6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine (PubChem CID 5261038) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 4-(6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine.
| Compound Name | 4-(6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 5261038 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-(6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)morpholine |
| SMILES | C=CCN1CCc2nc(-c3ccncc3)nc(N3CCOCC3)c2C1 |
| InChI | InChI=1S/C19H23N5O/c1-2-8-23-9-5-17-16(14-23)19(24-10-12-25-13-11-24)22-18(21-17)15-3-6-20-7-4-15/h2-4,6-7H,1,5,8-14H2 |
| InChIKey | NLZPWNMHBXHDKA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|