C20H26N6 — CID 5261044
4-(4-methylpiperazin-1-yl)-6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 5261044) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 5261044 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-prop-2-enyl-2-pyridin-4-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | C=CCN1CCc2nc(-c3ccncc3)nc(N3CCN(C)CC3)c2C1 |
| InChI | InChI=1S/C20H26N6/c1-3-9-25-10-6-18-17(15-25)20(26-13-11-24(2)12-14-26)23-19(22-18)16-4-7-21-8-5-16/h3-5,7-8H,1,6,9-15H2,2H3 |
| InChIKey | DZLBOLKDRVRPOH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|