C7H13F3N2O2 — CID 52623095
1-[(2S)-1-hydroxybutan-2-yl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 52623095) has the molecular formula C7H13F3N2O2 and a molecular weight of 214.19 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxybutan-2-yl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(2S)-1-hydroxybutan-2-yl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 52623095 |
| Molecular Formula | C7H13F3N2O2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-[(2S)-1-hydroxybutan-2-yl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC[C@@H](CO)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O2/c1-2-5(3-13)12-6(14)11-4-7(8,9)10/h5,13H,2-4H2,1H3,(H2,11,12,14)/t5-/m0/s1 |
| InChIKey | PZVZCCVTISVNRH-YFKPBYRVSA-N |
| XLogP | 0.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |