C20H11Br2NO5 — CID 5262445
(5,7-dibromoquinolin-8-yl) 7-methoxy-2-oxochromene-3-carboxylate (PubChem CID 5262445) has the molecular formula C20H11Br2NO5 and a molecular weight of 505.12 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) 7-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | (5,7-dibromoquinolin-8-yl) 7-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 5262445 |
| Molecular Formula | C20H11Br2NO5 |
| Molecular Weight | 505.12 g/mol |
| Exact Mass | 502.90 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) 7-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1ccc2cc(C(=O)Oc3c(Br)cc(Br)c4cccnc34)c(=O)oc2c1 |
| InChI | InChI=1S/C20H11Br2NO5/c1-26-11-5-4-10-7-13(19(24)27-16(10)8-11)20(25)28-18-15(22)9-14(21)12-3-2-6-23-17(12)18/h2-9H,1H3 |
| InChIKey | QDPFGEXDZAVNDU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.12 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|