About (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate
(5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate (PubChem CID 50939883) has the molecular formula C13H7Br2N3O2S
and a molecular weight of 429.09 g/mol. Its IUPAC name is (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate.
Molecular Properties
| Compound Name | (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate |
| PubChem CID | 50939883 |
| Molecular Formula | C13H7Br2N3O2S |
| Molecular Weight | 429.09 g/mol |
| Exact Mass | 426.86 |
| IUPAC Name | (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate |
| SMILES | Cc1nnsc1C(=O)Oc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C13H7Br2N3O2S/c1-6-12(21-18-17-6)13(19)20-11-9(15)5-8(14)7-3-2-4-16-10(7)11/h2-5H,1H3 |
| InChIKey | STYJNOPFGNLURA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.09 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate?
The IUPAC name of (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate (CID 50939883) is (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate.
What is the SMILES notation for (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate?
The canonical SMILES for (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate is Cc1nnsc1C(=O)Oc1c(Br)cc(Br)c2cccnc12.
What is the InChIKey of (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate?
The InChIKey is STYJNOPFGNLURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Br2N3O2S/c1-6-12(21-18-17-6)13(19)20-11-9(15)5-8(14)7-3-2-4-16-10(7)11/h2-5H,1H3.
What are the key properties of (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate?
(5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate has a molecular weight of 429.09 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dibromoquinolin-8-yl) 4-methylthiadiazole-5-carboxylate is sourced from PubChem (CID 50939883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).