C22H25ClN4O3S — CID 52625014
2-[4-[2-[(3-chlorophenyl)methyl-ethylamino]acetyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 52625014) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is 2-[4-[2-[(3-chlorophenyl)methyl-ethylamino]acetyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[2-[(3-chlorophenyl)methyl-ethylamino]acetyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 52625014 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-[4-[2-[(3-chlorophenyl)methyl-ethylamino]acetyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | CCN(CC(=O)N1CCN(S(=O)(=O)c2ccccc2C#N)CC1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-2-25(16-18-6-5-8-20(23)14-18)17-22(28)26-10-12-27(13-11-26)31(29,30)21-9-4-3-7-19(21)15-24/h3-9,14H,2,10-13,16-17H2,1H3 |
| InChIKey | NUJJTSRLXGSUPI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |