C12H5Br3O — CID 526349
2,6,7-tribromodibenzofuran (PubChem CID 526349) has the molecular formula C12H5Br3O and a molecular weight of 404.88 g/mol. Its IUPAC name is 2,6,7-tribromodibenzofuran.
| Compound Name | 2,6,7-tribromodibenzofuran |
|---|---|
| PubChem CID | 526349 |
| Molecular Formula | C12H5Br3O |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 401.79 |
| IUPAC Name | 2,6,7-tribromodibenzofuran |
| SMILES | Brc1ccc2oc3c(Br)c(Br)ccc3c2c1 |
| InChI | InChI=1S/C12H5Br3O/c13-6-1-4-10-8(5-6)7-2-3-9(14)11(15)12(7)16-10/h1-5H |
| InChIKey | GBBHZWUDKSMEOG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |