About 2,6,7-tribromodibenzofuran
2,6,7-tribromodibenzofuran (PubChem CID 526349) has the molecular formula C12H5Br3O
and a molecular weight of 404.88 g/mol. Its IUPAC name is 2,6,7-tribromodibenzofuran.
Molecular Properties
| Compound Name | 2,6,7-tribromodibenzofuran |
| PubChem CID | 526349 |
| Molecular Formula | C12H5Br3O |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 401.79 |
| IUPAC Name | 2,6,7-tribromodibenzofuran |
| SMILES | Brc1ccc2oc3c(Br)c(Br)ccc3c2c1 |
| InChI | InChI=1S/C12H5Br3O/c13-6-1-4-10-8(5-6)7-2-3-9(14)11(15)12(7)16-10/h1-5H |
| InChIKey | GBBHZWUDKSMEOG-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6,7-tribromodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,7-tribromodibenzofuran?
The IUPAC name of 2,6,7-tribromodibenzofuran (CID 526349) is 2,6,7-tribromodibenzofuran.
What is the SMILES notation for 2,6,7-tribromodibenzofuran?
The canonical SMILES for 2,6,7-tribromodibenzofuran is Brc1ccc2oc3c(Br)c(Br)ccc3c2c1.
What is the InChIKey of 2,6,7-tribromodibenzofuran?
The InChIKey is GBBHZWUDKSMEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Br3O/c13-6-1-4-10-8(5-6)7-2-3-9(14)11(15)12(7)16-10/h1-5H.
What are the key properties of 2,6,7-tribromodibenzofuran?
2,6,7-tribromodibenzofuran has a molecular weight of 404.88 g/mol, XLogP of 5.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,7-tribromodibenzofuran is sourced from PubChem (CID 526349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).