C21H16FN5O4S — CID 52645376
1-[(4-fluorophenyl)methyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 52645376) has the molecular formula C21H16FN5O4S and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 52645376 |
| Molecular Formula | C21H16FN5O4S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)C1=NN(Cc2ccc(F)cc2)C(=O)CC1 |
| InChI | InChI=1S/C21H16FN5O4S/c22-15-6-4-13(5-7-15)11-26-19(28)9-8-17(25-26)20(29)24-21-23-18(12-32-21)14-2-1-3-16(10-14)27(30)31/h1-7,10,12H,8-9,11H2,(H,23,24,29) |
| InChIKey | NUNGBPONBVUNPH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|