C24H26N4O3 — CID 52663080
N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 52663080) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 52663080 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-[4-[2-(N-ethylanilino)-2-oxoethyl]phenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | CCN(C(=O)Cc1ccc(NC(=O)C(=O)c2c(C)nn(C)c2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O3/c1-5-28(20-9-7-6-8-10-20)21(29)15-18-11-13-19(14-12-18)25-24(31)23(30)22-16(2)26-27(4)17(22)3/h6-14H,5,15H2,1-4H3,(H,25,31) |
| InChIKey | DUKLRUCTQZSKOU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|