C19H24N4O3 — CID 17458643
N,N-diethyl-4-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzamide (PubChem CID 17458643) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzamide.
| Compound Name | N,N-diethyl-4-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17458643 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N,N-diethyl-4-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)C(=O)c2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-6-23(7-2)19(26)14-8-10-15(11-9-14)20-18(25)17(24)16-12(3)21-22(5)13(16)4/h8-11H,6-7H2,1-5H3,(H,20,25) |
| InChIKey | OYDKQYUGXOVLLE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|