C16H16ClN3O4 — CID 134063107
methyl 2-chloro-5-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzoate (PubChem CID 134063107) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 134063107 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | methyl 2-chloro-5-[[2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)C(=O)c2c(C)nn(C)c2C)ccc1Cl |
| InChI | InChI=1S/C16H16ClN3O4/c1-8-13(9(2)20(3)19-8)14(21)15(22)18-10-5-6-12(17)11(7-10)16(23)24-4/h5-7H,1-4H3,(H,18,22) |
| InChIKey | JIPIGXFQEQZUSY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|