C17H22N4O4S — CID 17461114
N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 17461114) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 17461114 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)-4-methylphenyl]-2-oxo-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)c2c(C)nn(C)c2C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H22N4O4S/c1-10-7-8-13(9-14(10)26(24,25)20(4)5)18-17(23)16(22)15-11(2)19-21(6)12(15)3/h7-9H,1-6H3,(H,18,23) |
| InChIKey | NZIYHZILVMLZMF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|