C18H20F3N3O2 — CID 52665262
1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[3-(N-methylanilino)propyl]urea (PubChem CID 52665262) has the molecular formula C18H20F3N3O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[3-(N-methylanilino)propyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[3-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 52665262 |
| Molecular Formula | C18H20F3N3O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[3-(N-methylanilino)propyl]urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(OC(F)F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H20F3N3O2/c1-24(14-6-3-2-4-7-14)11-5-10-22-18(25)23-13-8-9-16(15(19)12-13)26-17(20)21/h2-4,6-9,12,17H,5,10-11H2,1H3,(H2,22,23,25) |
| InChIKey | ZXVGTEMACSMBAF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|