C19H22F3N3O2 — CID 60548052
1-[3-(N-methylanilino)propyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea (PubChem CID 60548052) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[3-(N-methylanilino)propyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea.
| Compound Name | 1-[3-(N-methylanilino)propyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 60548052 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[3-(N-methylanilino)propyl]-3-[3-(2,2,2-trifluoroethoxy)phenyl]urea |
| SMILES | CN(CCCNC(=O)Nc1cccc(OCC(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22F3N3O2/c1-25(16-8-3-2-4-9-16)12-6-11-23-18(26)24-15-7-5-10-17(13-15)27-14-19(20,21)22/h2-5,7-10,13H,6,11-12,14H2,1H3,(H2,23,24,26) |
| InChIKey | ZLOWTHTYKNVZKL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|