C23H28N4O2S — CID 5267867
6-(2,2-diphenylhydrazinyl)-N,N-di(propan-2-yl)pyridine-3-sulfonamide (PubChem CID 5267867) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 6-(2,2-diphenylhydrazinyl)-N,N-di(propan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(2,2-diphenylhydrazinyl)-N,N-di(propan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 5267867 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6-(2,2-diphenylhydrazinyl)-N,N-di(propan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)c1ccc(NN(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C23H28N4O2S/c1-18(2)27(19(3)4)30(28,29)22-15-16-23(24-17-22)25-26(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-19H,1-4H3,(H,24,25) |
| InChIKey | YDFFUQIMDRNOAO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|