C19H23N3OS — CID 52679182
5,6-dimethyl-N-[[2-(propoxymethyl)phenyl]methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 52679182) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 5,6-dimethyl-N-[[2-(propoxymethyl)phenyl]methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-N-[[2-(propoxymethyl)phenyl]methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 52679182 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 5,6-dimethyl-N-[[2-(propoxymethyl)phenyl]methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCOCc1ccccc1CNc1ncnc2sc(C)c(C)c12 |
| InChI | InChI=1S/C19H23N3OS/c1-4-9-23-11-16-8-6-5-7-15(16)10-20-18-17-13(2)14(3)24-19(17)22-12-21-18/h5-8,12H,4,9-11H2,1-3H3,(H,20,21,22) |
| InChIKey | SVMMOJIOBWKBKZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|