C17H17IN2O4 — CID 52693589
N-[2-[(3-hydroxy-4-methoxyphenyl)methylamino]-2-oxoethyl]-2-iodobenzamide (PubChem CID 52693589) has the molecular formula C17H17IN2O4 and a molecular weight of 440.24 g/mol. Its IUPAC name is N-[2-[(3-hydroxy-4-methoxyphenyl)methylamino]-2-oxoethyl]-2-iodobenzamide.
| Compound Name | N-[2-[(3-hydroxy-4-methoxyphenyl)methylamino]-2-oxoethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 52693589 |
| Molecular Formula | C17H17IN2O4 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N-[2-[(3-hydroxy-4-methoxyphenyl)methylamino]-2-oxoethyl]-2-iodobenzamide |
| SMILES | COc1ccc(CNC(=O)CNC(=O)c2ccccc2I)cc1O |
| InChI | InChI=1S/C17H17IN2O4/c1-24-15-7-6-11(8-14(15)21)9-19-16(22)10-20-17(23)12-4-2-3-5-13(12)18/h2-8,21H,9-10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | VWASNEAWUKQUGL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|