C13H11F2NO3 — CID 5270600
2-[(2,3-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid (PubChem CID 5270600) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid.
| Compound Name | 2-[(2,3-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 5270600 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[(2,3-difluorophenyl)carbamoyl]cyclopentene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)Nc2cccc(F)c2F)CCC1 |
| InChI | InChI=1S/C13H11F2NO3/c14-9-5-2-6-10(11(9)15)16-12(17)7-3-1-4-8(7)13(18)19/h2,5-6H,1,3-4H2,(H,16,17)(H,18,19) |
| InChIKey | YJUMDCCHISBTDM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |