C12H5Cl3S — CID 527120
1,3,6-trichlorodibenzothiophene (PubChem CID 527120) has the molecular formula C12H5Cl3S and a molecular weight of 287.60 g/mol. Its IUPAC name is 1,3,6-trichlorodibenzothiophene.
| Compound Name | 1,3,6-trichlorodibenzothiophene |
|---|---|
| PubChem CID | 527120 |
| Molecular Formula | C12H5Cl3S |
| Molecular Weight | 287.60 g/mol |
| Exact Mass | 285.92 |
| IUPAC Name | 1,3,6-trichlorodibenzothiophene |
| SMILES | Clc1cc(Cl)c2c(c1)sc1c(Cl)cccc12 |
| InChI | InChI=1S/C12H5Cl3S/c13-6-4-9(15)11-7-2-1-3-8(14)12(7)16-10(11)5-6/h1-5H |
| InChIKey | VDWPANJZXVXRCC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |