C13H5Cl2NS2 — CID 171455467
2,8-dichloro-[1]benzothiolo[2,3-f][1,3]benzothiazole (PubChem CID 171455467) has the molecular formula C13H5Cl2NS2 and a molecular weight of 310.23 g/mol. Its IUPAC name is 2,8-dichloro-[1]benzothiolo[2,3-f][1,3]benzothiazole.
| Compound Name | 2,8-dichloro-[1]benzothiolo[2,3-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 171455467 |
| Molecular Formula | C13H5Cl2NS2 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 308.92 |
| IUPAC Name | 2,8-dichloro-[1]benzothiolo[2,3-f][1,3]benzothiazole |
| SMILES | Clc1nc2cc3sc4c(Cl)cccc4c3cc2s1 |
| InChI | InChI=1S/C13H5Cl2NS2/c14-8-3-1-2-6-7-4-11-9(16-13(15)18-11)5-10(7)17-12(6)8/h1-5H |
| InChIKey | YTRGMWPTIXFTKA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |