C19H9ClNOS+ — CID 171456332
8-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzoxazole (PubChem CID 171456332) has the molecular formula C19H9ClNOS+ and a molecular weight of 334.81 g/mol. Its IUPAC name is 8-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzoxazole.
| Compound Name | 8-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 171456332 |
| Molecular Formula | C19H9ClNOS+ |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 8-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzoxazole |
| SMILES | Clc1cccc2c1sc1cc3oc(C4=CC=[C+]C=C4)nc3cc12 |
| InChI | InChI=1S/C19H9ClNOS/c20-14-8-4-7-12-13-9-15-16(10-17(13)23-18(12)14)22-19(21-15)11-5-2-1-3-6-11/h2-10H/q+1 |
| InChIKey | APKYUSXRCDFINP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|