C19H9ClNS2+ — CID 171456494
6-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzothiazole (PubChem CID 171456494) has the molecular formula C19H9ClNS2+ and a molecular weight of 350.88 g/mol. Its IUPAC name is 6-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzothiazole.
| Compound Name | 6-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 171456494 |
| Molecular Formula | C19H9ClNS2+ |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 6-chloro-2-(cyclohexatrienyl)-[1]benzothiolo[3,2-f][1,3]benzothiazole |
| SMILES | Clc1ccc2sc3cc4sc(C5=CC=[C+]C=C5)nc4cc3c2c1 |
| InChI | InChI=1S/C19H9ClNS2/c20-12-6-7-16-13(8-12)14-9-15-18(10-17(14)22-16)23-19(21-15)11-4-2-1-3-5-11/h2-10H/q+1 |
| InChIKey | HZQBYANTKKTUAQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|