C11H12BrN5O2 — CID 52712978
N-[2-(3-bromophenoxy)ethyl]-2-(tetrazol-1-yl)acetamide (PubChem CID 52712978) has the molecular formula C11H12BrN5O2 and a molecular weight of 326.15 g/mol. Its IUPAC name is N-[2-(3-bromophenoxy)ethyl]-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-[2-(3-bromophenoxy)ethyl]-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 52712978 |
| Molecular Formula | C11H12BrN5O2 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-[2-(3-bromophenoxy)ethyl]-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)NCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C11H12BrN5O2/c12-9-2-1-3-10(6-9)19-5-4-13-11(18)7-17-8-14-15-16-17/h1-3,6,8H,4-5,7H2,(H,13,18) |
| InChIKey | SAPTWSYXTUDAJQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|