C23H18F5N3OS — CID 5272232
2-fluoro-N-[4-[1-(4-fluorophenyl)ethylcarbamothioylamino]-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 5272232) has the molecular formula C23H18F5N3OS and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-fluoro-N-[4-[1-(4-fluorophenyl)ethylcarbamothioylamino]-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[1-(4-fluorophenyl)ethylcarbamothioylamino]-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 5272232 |
| Molecular Formula | C23H18F5N3OS |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-fluoro-N-[4-[1-(4-fluorophenyl)ethylcarbamothioylamino]-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(NC(=S)Nc1ccc(NC(=O)c2ccccc2F)c(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18F5N3OS/c1-13(14-6-8-15(24)9-7-14)29-22(33)30-16-10-11-20(18(12-16)23(26,27)28)31-21(32)17-4-2-3-5-19(17)25/h2-13H,1H3,(H,31,32)(H2,29,30,33) |
| InChIKey | MDUDHPUGGCLMJR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|