C22H17Br2F2N3OS — CID 5272233
N-[2,6-dibromo-4-[1-(4-fluorophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide (PubChem CID 5272233) has the molecular formula C22H17Br2F2N3OS and a molecular weight of 569.27 g/mol. Its IUPAC name is N-[2,6-dibromo-4-[1-(4-fluorophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[2,6-dibromo-4-[1-(4-fluorophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 5272233 |
| Molecular Formula | C22H17Br2F2N3OS |
| Molecular Weight | 569.27 g/mol |
| Exact Mass | 566.94 |
| IUPAC Name | N-[2,6-dibromo-4-[1-(4-fluorophenyl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide |
| SMILES | CC(NC(=S)Nc1cc(Br)c(NC(=O)c2ccccc2F)c(Br)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17Br2F2N3OS/c1-12(13-6-8-14(25)9-7-13)27-22(31)28-15-10-17(23)20(18(24)11-15)29-21(30)16-4-2-3-5-19(16)26/h2-12H,1H3,(H,29,30)(H2,27,28,31) |
| InChIKey | INJAODVGTHETNS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.27 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|