C23H21F2N3OS — CID 5272220
2-fluoro-N-[4-[1-(4-fluorophenyl)propylcarbamothioylamino]phenyl]benzamide (PubChem CID 5272220) has the molecular formula C23H21F2N3OS and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-fluoro-N-[4-[1-(4-fluorophenyl)propylcarbamothioylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[1-(4-fluorophenyl)propylcarbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 5272220 |
| Molecular Formula | C23H21F2N3OS |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-fluoro-N-[4-[1-(4-fluorophenyl)propylcarbamothioylamino]phenyl]benzamide |
| SMILES | CCC(NC(=S)Nc1ccc(NC(=O)c2ccccc2F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21F2N3OS/c1-2-21(15-7-9-16(24)10-8-15)28-23(30)27-18-13-11-17(12-14-18)26-22(29)19-5-3-4-6-20(19)25/h3-14,21H,2H2,1H3,(H,26,29)(H2,27,28,30) |
| InChIKey | BHIIVWVVZCOJKU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|