C20H22N4O4 — CID 52723980
N-[3-[2-[(2-butylpyrazol-3-yl)amino]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 52723980) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[3-[2-[(2-butylpyrazol-3-yl)amino]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[(2-butylpyrazol-3-yl)amino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 52723980 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[3-[2-[(2-butylpyrazol-3-yl)amino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | CCCCn1nccc1NC(=O)COc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-2-3-11-24-18(9-10-21-24)23-19(25)14-28-16-7-4-6-15(13-16)22-20(26)17-8-5-12-27-17/h4-10,12-13H,2-3,11,14H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | HUGYGOABMBFLHJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |