C11H12N4S2 — CID 5273670
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarbothioamide (PubChem CID 5273670) has the molecular formula C11H12N4S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarbothioamide.
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 5273670 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzenecarbothioamide |
| SMILES | Cn1cnnc1SCc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C11H12N4S2/c1-15-7-13-14-11(15)17-6-8-2-4-9(5-3-8)10(12)16/h2-5,7H,6H2,1H3,(H2,12,16) |
| InChIKey | HNQILKLGEOAWES-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|