C20H23BrN2O3S — CID 52736733
N-(3-bromophenyl)-2-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]sulfanylacetamide (PubChem CID 52736733) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]sulfanylacetamide.
| Compound Name | N-(3-bromophenyl)-2-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 52736733 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-(3-bromophenyl)-2-[2-(5-tert-butyl-2-hydroxyanilino)-2-oxoethyl]sulfanylacetamide |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)CSCC(=O)Nc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-20(2,3)13-7-8-17(24)16(9-13)23-19(26)12-27-11-18(25)22-15-6-4-5-14(21)10-15/h4-10,24H,11-12H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | OZLYMUPUMOMOGU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|