C11H16N2O2Si — CID 5273945
2-(2,4-dimethoxypyrimidin-5-yl)ethynyl-trimethylsilane (PubChem CID 5273945) has the molecular formula C11H16N2O2Si and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-(2,4-dimethoxypyrimidin-5-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(2,4-dimethoxypyrimidin-5-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 5273945 |
| Molecular Formula | C11H16N2O2Si |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(2,4-dimethoxypyrimidin-5-yl)ethynyl-trimethylsilane |
| SMILES | COc1ncc(C#C[Si](C)(C)C)c(OC)n1 |
| InChI | InChI=1S/C11H16N2O2Si/c1-14-10-9(6-7-16(3,4)5)8-12-11(13-10)15-2/h8H,1-5H3 |
| InChIKey | PANGXXUVOCXPSU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|