C11H13BrN4O3 — CID 5274102
(2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 5274102) has the molecular formula C11H13BrN4O3 and a molecular weight of 329.15 g/mol. Its IUPAC name is (2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 5274102 |
| Molecular Formula | C11H13BrN4O3 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (2R,3R,4S,5S)-5-(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-4-bromo-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3Br)c[nH]c12 |
| InChI | InChI=1S/C11H13BrN4O3/c12-6-9(18)5(2-17)19-10(6)4-1-14-8-7(4)15-3-16-11(8)13/h1,3,5-6,9-10,14,17-18H,2H2,(H2,13,15,16)/t5-,6+,9-,10+/m1/s1 |
| InChIKey | MRSWFPRHZLAGJI-FXUQCPSJSA-N |
| XLogP | 0.10 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|