C29H32N4O2S — CID 5274769
2-(cyclohexanecarbonylamino)-N-[3-(naphthalen-2-ylmethylamino)propyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 5274769) has the molecular formula C29H32N4O2S and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-(cyclohexanecarbonylamino)-N-[3-(naphthalen-2-ylmethylamino)propyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(cyclohexanecarbonylamino)-N-[3-(naphthalen-2-ylmethylamino)propyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 5274769 |
| Molecular Formula | C29H32N4O2S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-(cyclohexanecarbonylamino)-N-[3-(naphthalen-2-ylmethylamino)propyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(NCCCNCc1ccc2ccccc2c1)c1ccc2nc(NC(=O)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C29H32N4O2S/c34-27(31-16-6-15-30-19-20-11-12-21-7-4-5-10-23(21)17-20)24-13-14-25-26(18-24)36-29(32-25)33-28(35)22-8-2-1-3-9-22/h4-5,7,10-14,17-18,22,30H,1-3,6,8-9,15-16,19H2,(H,31,34)(H,32,33,35) |
| InChIKey | NCUSUDWRZAUCEC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|