C37H44O14 — CID 5275791
[(1R,2R,3R,4S,5S,7R,8S,9R,11S)-1,2,8,11,16-pentaacetyloxy-7-hydroxy-5,9,12,12-tetramethyl-13-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadec-10(14)-enyl] benzoate (PubChem CID 5275791) has the molecular formula C37H44O14 and a molecular weight of 712.75 g/mol. Its IUPAC name is [(1R,2R,3R,4S,5S,7R,8S,9R,11S)-1,2,8,11,16-pentaacetyloxy-7-hydroxy-5,9,12,12-tetramethyl-13-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadec-10(14)-enyl] benzoate.
| Compound Name | [(1R,2R,3R,4S,5S,7R,8S,9R,11S)-1,2,8,11,16-pentaacetyloxy-7-hydroxy-5,9,12,12-tetramethyl-13-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadec-10(14)-enyl] benzoate |
|---|---|
| PubChem CID | 5275791 |
| Molecular Formula | C37H44O14 |
| Molecular Weight | 712.75 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | [(1R,2R,3R,4S,5S,7R,8S,9R,11S)-1,2,8,11,16-pentaacetyloxy-7-hydroxy-5,9,12,12-tetramethyl-13-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadec-10(14)-enyl] benzoate |
| SMILES | CC(=O)OC1[C@@]2(OC(C)=O)CC3=C([C@H](OC(C)=O)C(C)(C)C3=O)[C@]1(C)[C@H](OC(C)=O)[C@@]1(O)C[C@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]1[C@H]2OC(C)=O |
| InChI | InChI=1S/C37H44O14/c1-17-15-36(45)26(27(17)50-31(44)23-13-11-10-12-14-23)30(47-19(3)39)37(51-22(6)42)16-24-25(29(46-18(2)38)34(7,8)28(24)43)35(9,32(36)48-20(4)40)33(37)49-21(5)41/h10-14,17,26-27,29-30,32-33,45H,15-16H2,1-9H3/t17-,26+,27-,29-,30+,32-,33?,35+,36+,37+/m0/s1 |
| InChIKey | SWSXELQHTSGROU-BFWGZRPSSA-N |
| XLogP | 2.96 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|