C18H22N2O5S — CID 52764758
N,3-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]-4-nitroaniline (PubChem CID 52764758) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is N,3-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]-4-nitroaniline.
| Compound Name | N,3-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]-4-nitroaniline |
|---|---|
| PubChem CID | 52764758 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N,3-dimethyl-N-[3-(4-methylsulfonylphenoxy)propyl]-4-nitroaniline |
| SMILES | Cc1cc(N(C)CCCOc2ccc(S(C)(=O)=O)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O5S/c1-14-13-15(5-10-18(14)20(21)22)19(2)11-4-12-25-16-6-8-17(9-7-16)26(3,23)24/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | HXACPAAQHHIHIO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|