C28H45N3O7S — CID 5279072
(4S)-4-[[5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-5-oxo-5-(3-thiophen-2-ylpropylamino)pentanoic acid (PubChem CID 5279072) has the molecular formula C28H45N3O7S and a molecular weight of 567.75 g/mol. Its IUPAC name is (4S)-4-[[5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-5-oxo-5-(3-thiophen-2-ylpropylamino)pentanoic acid.
| Compound Name | (4S)-4-[[5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-5-oxo-5-(3-thiophen-2-ylpropylamino)pentanoic acid |
|---|---|
| PubChem CID | 5279072 |
| Molecular Formula | C28H45N3O7S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | (4S)-4-[[5-cyclohexyl-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-5-oxo-5-(3-thiophen-2-ylpropylamino)pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCCC1)C(O)CC(=O)N[C@@H](CCC(=O)O)C(=O)NCCCc1cccs1 |
| InChI | InChI=1S/C28H45N3O7S/c1-28(2,3)38-27(37)31-22(17-19-9-5-4-6-10-19)23(32)18-24(33)30-21(13-14-25(34)35)26(36)29-15-7-11-20-12-8-16-39-20/h8,12,16,19,21-23,32H,4-7,9-11,13-15,17-18H2,1-3H3,(H,29,36)(H,30,33)(H,31,37)(H,34,35)/t21-,22?,23?/m0/s1 |
| InChIKey | HIRZJJRVZQNMPF-UVKLAMSESA-N |
| XLogP | 3.76 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|