C15H12BrClN4O3 — CID 52793296
5-bromo-N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 52793296) has the molecular formula C15H12BrClN4O3 and a molecular weight of 411.64 g/mol. Its IUPAC name is 5-bromo-N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 52793296 |
| Molecular Formula | C15H12BrClN4O3 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 5-bromo-N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | Cn1c(NC(=O)CNC(=O)c2ccc(Br)o2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H12BrClN4O3/c1-21-10-3-2-8(17)6-9(10)19-15(21)20-13(22)7-18-14(23)11-4-5-12(16)24-11/h2-6H,7H2,1H3,(H,18,23)(H,19,20,22) |
| InChIKey | NANDPUPQPKMJPL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |