C15H13ClN4O3 — CID 51099324
N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-3-carboxamide (PubChem CID 51099324) has the molecular formula C15H13ClN4O3 and a molecular weight of 332.75 g/mol. Its IUPAC name is N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-3-carboxamide.
| Compound Name | N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 51099324 |
| Molecular Formula | C15H13ClN4O3 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-[2-[(5-chloro-1-methylbenzimidazol-2-yl)amino]-2-oxoethyl]furan-3-carboxamide |
| SMILES | Cn1c(NC(=O)CNC(=O)c2ccoc2)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H13ClN4O3/c1-20-12-3-2-10(16)6-11(12)18-15(20)19-13(21)7-17-14(22)9-4-5-23-8-9/h2-6,8H,7H2,1H3,(H,17,22)(H,18,19,21) |
| InChIKey | KSGPYTPXABGLCA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |