C19H26N2O3S — CID 52816902
(2R)-2-but-3-enoxy-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]propanamide (PubChem CID 52816902) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is (2R)-2-but-3-enoxy-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]propanamide.
| Compound Name | (2R)-2-but-3-enoxy-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 52816902 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (2R)-2-but-3-enoxy-N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]propanamide |
| SMILES | C=CCCO[C@H](C)C(=O)Nc1ccc(CC(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C19H26N2O3S/c1-3-4-11-24-15(2)19(23)20-17-7-5-16(6-8-17)14-18(22)21-9-12-25-13-10-21/h3,5-8,15H,1,4,9-14H2,2H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | AFNZMXVBONEXRS-OAHLLOKOSA-N |
| XLogP | 2.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|