C26H46N2O — CID 5283407
(5Z,8Z,11Z,14Z)-N-[2-(diethylamino)ethyl]icosa-5,8,11,14-tetraenamide (PubChem CID 5283407) has the molecular formula C26H46N2O and a molecular weight of 402.67 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[2-(diethylamino)ethyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[2-(diethylamino)ethyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 5283407 |
| Molecular Formula | C26H46N2O |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.36 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[2-(diethylamino)ethyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C26H46N2O/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26(29)27-24-25-28(5-2)6-3/h10-11,13-14,16-17,19-20H,4-9,12,15,18,21-25H2,1-3H3,(H,27,29)/b11-10-,14-13-,17-16-,20-19- |
| InChIKey | LOZCJJDEBAPQGP-AILJCPQKSA-N |
| XLogP | 6.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|