C17H20ClNO2S — CID 52852570
4-(3-chloropropyl)-N-(2,6-dimethylphenyl)benzenesulfonamide (PubChem CID 52852570) has the molecular formula C17H20ClNO2S and a molecular weight of 337.87 g/mol. Its IUPAC name is 4-(3-chloropropyl)-N-(2,6-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-(3-chloropropyl)-N-(2,6-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 52852570 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-(3-chloropropyl)-N-(2,6-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(CCCCl)cc1 |
| InChI | InChI=1S/C17H20ClNO2S/c1-13-5-3-6-14(2)17(13)19-22(20,21)16-10-8-15(9-11-16)7-4-12-18/h3,5-6,8-11,19H,4,7,12H2,1-2H3 |
| InChIKey | OWMPKHDSUJYWFN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|